About [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate
[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate (PubChem CID 11394909) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate.
Molecular Properties
| Compound Name | [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate |
| PubChem CID | 11394909 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate |
| SMILES | Cc1cccc(N(C)C(=O)Oc2ccc(N3C(=O)CC(C)(C)CC3=O)cn2)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-14-6-5-7-15(10-14)23(4)20(27)28-17-9-8-16(13-22-17)24-18(25)11-21(2,3)12-19(24)26/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | URMQJXJXIJAFDS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate?
The IUPAC name of [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate (CID 11394909) is [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate.
What is the SMILES notation for [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate?
The canonical SMILES for [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate is Cc1cccc(N(C)C(=O)Oc2ccc(N3C(=O)CC(C)(C)CC3=O)cn2)c1.
What is the InChIKey of [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate?
The InChIKey is URMQJXJXIJAFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-14-6-5-7-15(10-14)23(4)20(27)28-17-9-8-16(13-22-17)24-18(25)11-21(2,3)12-19(24)26/h5-10,13H,11-12H2,1-4H3.
What are the key properties of [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate?
[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate has a molecular weight of 381.43 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)-2-pyridinyl] N-methyl-N-(3-methylphenyl)carbamate is sourced from PubChem (CID 11394909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).