C19H31NO5Si — CID 11394922
(3aR,6R,7S,7aR)-2,2-dimethyl-7-phenylmethoxy-6-(trimethylsilyloxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-amine (PubChem CID 11394922) has the molecular formula C19H31NO5Si and a molecular weight of 381.55 g/mol. Its IUPAC name is (3aR,6R,7S,7aR)-2,2-dimethyl-7-phenylmethoxy-6-(trimethylsilyloxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-amine.
| Compound Name | (3aR,6R,7S,7aR)-2,2-dimethyl-7-phenylmethoxy-6-(trimethylsilyloxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-amine |
|---|---|
| PubChem CID | 11394922 |
| Molecular Formula | C19H31NO5Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | (3aR,6R,7S,7aR)-2,2-dimethyl-7-phenylmethoxy-6-(trimethylsilyloxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@](N)(CO[Si](C)(C)C)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C19H31NO5Si/c1-18(2)24-15-12-22-19(20,13-23-26(3,4)5)17(16(15)25-18)21-11-14-9-7-6-8-10-14/h6-10,15-17H,11-13,20H2,1-5H3/t15-,16-,17+,19-/m1/s1 |
| InChIKey | QWXVZEKSNKNIIT-VXIBKDFQSA-N |
| XLogP | 2.63 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|