C20H34O5Si — CID 11394955
(E)-4-[(1'S,5'R,6'R)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxane-2,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3'-yl]-2-methylbut-3-en-2-ol (PubChem CID 11394955) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is (E)-4-[(1'S,5'R,6'R)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxane-2,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3'-yl]-2-methylbut-3-en-2-ol.
| Compound Name | (E)-4-[(1'S,5'R,6'R)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxane-2,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3'-yl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 11394955 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (E)-4-[(1'S,5'R,6'R)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxane-2,2'-7-oxabicyclo[4.1.0]hept-3-ene]-3'-yl]-2-methylbut-3-en-2-ol |
| SMILES | CC(C)(O)/C=C/C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@@H]2C12OCCCO2 |
| InChI | InChI=1S/C20H34O5Si/c1-18(2,3)26(6,7)25-15-13-14(9-10-19(4,5)21)20(17-16(15)24-17)22-11-8-12-23-20/h9-10,13,15-17,21H,8,11-12H2,1-7H3/b10-9+/t15-,16+,17+/m1/s1 |
| InChIKey | UOXWISMERMYGTD-NQQDEJRESA-N |
| XLogP | 3.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|