About N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 1139497) has the molecular formula C27H26N2O4S
and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 1139497 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(CCN(C(=O)COc2ccccc2)c2nc(-c3ccccc3)cs2)cc1OC |
| InChI | InChI=1S/C27H26N2O4S/c1-31-24-14-13-20(17-25(24)32-2)15-16-29(26(30)18-33-22-11-7-4-8-12-22)27-28-23(19-34-27)21-9-5-3-6-10-21/h3-14,17,19H,15-16,18H2,1-2H3 |
| InChIKey | ZEQDNYJYTDOTJH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (CID 1139497) is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is COc1ccc(CCN(C(=O)COc2ccccc2)c2nc(-c3ccccc3)cs2)cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is ZEQDNYJYTDOTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O4S/c1-31-24-14-13-20(17-25(24)32-2)15-16-29(26(30)18-33-22-11-7-4-8-12-22)27-28-23(19-34-27)21-9-5-3-6-10-21/h3-14,17,19H,15-16,18H2,1-2H3.
What are the key properties of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 474.58 g/mol, XLogP of 5.48, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 1139497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).