C19H16BrFN2O — CID 11395078
N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-4-fluorobenzamide (PubChem CID 11395078) has the molecular formula C19H16BrFN2O and a molecular weight of 387.25 g/mol. Its IUPAC name is N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-4-fluorobenzamide.
| Compound Name | N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 11395078 |
| Molecular Formula | C19H16BrFN2O |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-(6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-4-fluorobenzamide |
| SMILES | O=C(NC1CCCc2c1[nH]c1ccc(Br)cc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16BrFN2O/c20-12-6-9-16-15(10-12)14-2-1-3-17(18(14)22-16)23-19(24)11-4-7-13(21)8-5-11/h4-10,17,22H,1-3H2,(H,23,24) |
| InChIKey | NUMNOLWLEWXOHU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|