C18H24N6O4 — CID 11395115
N-hydroxy-N-[[1-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cycloheptyl]methyl]formamide (PubChem CID 11395115) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-hydroxy-N-[[1-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cycloheptyl]methyl]formamide.
| Compound Name | N-hydroxy-N-[[1-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cycloheptyl]methyl]formamide |
|---|---|
| PubChem CID | 11395115 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-hydroxy-N-[[1-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]cycloheptyl]methyl]formamide |
| SMILES | COc1ccc2nc(NNC(=O)C3(CN(O)C=O)CCCCCC3)nnc2c1 |
| InChI | InChI=1S/C18H24N6O4/c1-28-13-6-7-14-15(10-13)20-22-17(19-14)23-21-16(26)18(11-24(27)12-25)8-4-2-3-5-9-18/h6-7,10,12,27H,2-5,8-9,11H2,1H3,(H,21,26)(H,19,22,23) |
| InChIKey | QYTXJEKEIBWYTG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|