C26H18N2O2 — CID 11395174
13-methyl-3-prop-2-enyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione (PubChem CID 11395174) has the molecular formula C26H18N2O2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 13-methyl-3-prop-2-enyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione.
| Compound Name | 13-methyl-3-prop-2-enyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione |
|---|---|
| PubChem CID | 11395174 |
| Molecular Formula | C26H18N2O2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 13-methyl-3-prop-2-enyl-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosa-1(24),2(10),4,6,8,11(15),16,18,20,22-decaene-12,14-dione |
| SMILES | C=CCn1c2ccccc2c2c3c(c4cc5ccccc5cc4c21)C(=O)N(C)C3=O |
| InChI | InChI=1S/C26H18N2O2/c1-3-12-28-20-11-7-6-10-17(20)21-23-22(25(29)27(2)26(23)30)18-13-15-8-4-5-9-16(15)14-19(18)24(21)28/h3-11,13-14H,1,12H2,2H3 |
| InChIKey | CKKOIRGGQUBZRI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|