C23H44O2Si2 — CID 11395717
(4E,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-6-trimethylsilylcyclooct-4-en-1-one (PubChem CID 11395717) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is (4E,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-6-trimethylsilylcyclooct-4-en-1-one.
| Compound Name | (4E,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-6-trimethylsilylcyclooct-4-en-1-one |
|---|---|
| PubChem CID | 11395717 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (4E,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-cyclohexyl-6-trimethylsilylcyclooct-4-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O/C1=C/[C@H]([Si](C)(C)C)[C@H](C2CCCCC2)CC(=O)CC1 |
| InChI | InChI=1S/C23H44O2Si2/c1-23(2,3)27(7,8)25-20-15-14-19(24)16-21(18-12-10-9-11-13-18)22(17-20)26(4,5)6/h17-18,21-22H,9-16H2,1-8H3/b20-17+/t21-,22-/m0/s1 |
| InChIKey | AUZLXWQPPJIXGC-XPYBYMAJSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|