C16H26O12 — CID 11395760
[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 11395760) has the molecular formula C16H26O12 and a molecular weight of 410.37 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11395760 |
| Molecular Formula | C16H26O12 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H26O12/c1-6(2)14(24)25-5-16(13(23)10(20)8(4-18)27-16)28-15-12(22)11(21)9(19)7(3-17)26-15/h7-13,15,17-23H,1,3-5H2,2H3/t7-,8-,9-,10-,11+,12-,13+,15-,16+/m1/s1 |
| InChIKey | IUXYZXYRGINANE-IUHJZARWSA-N |
| XLogP | -4.27 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|