About 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione
8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 11395842) has the molecular formula C20H26Cl2N2O3
and a molecular weight of 413.35 g/mol. Its IUPAC name is 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione |
| PubChem CID | 11395842 |
| Molecular Formula | C20H26Cl2N2O3 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | CN(CCOc1cc(Cl)ccc1Cl)CCN1C(=O)CC2(CCCC2)CC1=O |
| InChI | InChI=1S/C20H26Cl2N2O3/c1-23(10-11-27-17-12-15(21)4-5-16(17)22)8-9-24-18(25)13-20(14-19(24)26)6-2-3-7-20/h4-5,12H,2-3,6-11,13-14H2,1H3 |
| InChIKey | TZYSFWCODVUWBW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The IUPAC name of 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione (CID 11395842) is 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione is CN(CCOc1cc(Cl)ccc1Cl)CCN1C(=O)CC2(CCCC2)CC1=O.
What is the InChIKey of 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione?
The InChIKey is TZYSFWCODVUWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26Cl2N2O3/c1-23(10-11-27-17-12-15(21)4-5-16(17)22)8-9-24-18(25)13-20(14-19(24)26)6-2-3-7-20/h4-5,12H,2-3,6-11,13-14H2,1H3.
What are the key properties of 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione?
8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione has a molecular weight of 413.35 g/mol, XLogP of 4.01, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-[2-(2,5-dichlorophenoxy)ethyl-methylamino]ethyl]-8-azaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 11395842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).