C16H11Cl2N3O3 — CID 1139588
[2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate (PubChem CID 1139588) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
|---|---|
| PubChem CID | 1139588 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
| SMILES | O=C(Cn1nnc2ccccc21)OCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c17-11-6-5-10(7-12(11)18)15(22)9-24-16(23)8-21-14-4-2-1-3-13(14)19-20-21/h1-7H,8-9H2 |
| InChIKey | WVNMNGAZVHJAKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |