About 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol (PubChem CID 11395968) has the molecular formula C27H35N3O
and a molecular weight of 417.60 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol |
| PubChem CID | 11395968 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H35N3O/c1-26(2,3)21-15-20(25(31)24(16-21)27(4,5)6)17-30(18-22-11-7-9-13-28-22)19-23-12-8-10-14-29-23/h7-16,31H,17-19H2,1-6H3 |
| InChIKey | KZDFCSGDQVSVBE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol?
The IUPAC name of 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol (CID 11395968) is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol.
What is the SMILES notation for 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol?
The canonical SMILES for 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol is CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol?
The InChIKey is KZDFCSGDQVSVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35N3O/c1-26(2,3)21-15-20(25(31)24(16-21)27(4,5)6)17-30(18-22-11-7-9-13-28-22)19-23-12-8-10-14-29-23/h7-16,31H,17-19H2,1-6H3.
What are the key properties of 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol?
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol has a molecular weight of 417.60 g/mol, XLogP of 5.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenol is sourced from PubChem (CID 11395968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).