About 4-piperidin-4-ylpyridine
4-piperidin-4-ylpyridine (PubChem CID 1139597) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-piperidin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-piperidin-4-ylpyridine |
| PubChem CID | 1139597 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-piperidin-4-ylpyridine |
| SMILES | c1cc(C2CCNCC2)ccn1 |
| InChI | InChI=1S/C10H14N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-2,5-6,10,12H,3-4,7-8H2 |
| InChIKey | RGBWBVGQZFJTEO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-piperidin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-ylpyridine?
The IUPAC name of 4-piperidin-4-ylpyridine (CID 1139597) is 4-piperidin-4-ylpyridine.
What is the SMILES notation for 4-piperidin-4-ylpyridine?
The canonical SMILES for 4-piperidin-4-ylpyridine is c1cc(C2CCNCC2)ccn1.
What is the InChIKey of 4-piperidin-4-ylpyridine?
The InChIKey is RGBWBVGQZFJTEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-2,5-6,10,12H,3-4,7-8H2.
What are the key properties of 4-piperidin-4-ylpyridine?
4-piperidin-4-ylpyridine has a molecular weight of 162.24 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-ylpyridine is sourced from PubChem (CID 1139597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).