C24H41N3O3 — CID 11396024
(4S)-2-[1,2-bis[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-butan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 11396024) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is (4S)-2-[1,2-bis[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-butan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[1,2-bis[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-butan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11396024 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | (4S)-2-[1,2-bis[(4S)-4-butan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4-butan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC(C)[C@H]1COC(CC(C)(C2=N[C@@H](C(C)CC)CO2)C2=N[C@@H](C(C)CC)CO2)=N1 |
| InChI | InChI=1S/C24H41N3O3/c1-8-15(4)18-12-28-21(25-18)11-24(7,22-26-19(13-29-22)16(5)9-2)23-27-20(14-30-23)17(6)10-3/h15-20H,8-14H2,1-7H3/t15?,16?,17?,18-,19-,20-,24?/m1/s1 |
| InChIKey | NNRXDOHSEMDAJV-QHRORSMPSA-N |
| XLogP | 4.91 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |