C19H19FN2O6S — CID 11396093
N'-[(4-fluorophenyl)methyl]-N'-methoxy-N-(4-methylphenyl)sulfonyl-2-oxobutanediamide (PubChem CID 11396093) has the molecular formula C19H19FN2O6S and a molecular weight of 422.43 g/mol. Its IUPAC name is N'-[(4-fluorophenyl)methyl]-N'-methoxy-N-(4-methylphenyl)sulfonyl-2-oxobutanediamide.
| Compound Name | N'-[(4-fluorophenyl)methyl]-N'-methoxy-N-(4-methylphenyl)sulfonyl-2-oxobutanediamide |
|---|---|
| PubChem CID | 11396093 |
| Molecular Formula | C19H19FN2O6S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N'-[(4-fluorophenyl)methyl]-N'-methoxy-N-(4-methylphenyl)sulfonyl-2-oxobutanediamide |
| SMILES | CON(Cc1ccc(F)cc1)C(=O)CC(=O)C(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19FN2O6S/c1-13-3-9-16(10-4-13)29(26,27)21-19(25)17(23)11-18(24)22(28-2)12-14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,25) |
| InChIKey | HGZOGPBPBIYMTQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|