C24H30O5Si — CID 11396199
tert-butyl-[[(1R,2R,5S,6S)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl]oxy]-diphenylsilane (PubChem CID 11396199) has the molecular formula C24H30O5Si and a molecular weight of 426.59 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,5S,6S)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2R,5S,6S)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 11396199 |
| Molecular Formula | C24H30O5Si |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | tert-butyl-[[(1R,2R,5S,6S)-8-methyl-3,7,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-5-yl]oxy]-diphenylsilane |
| SMILES | CC12OC[C@@H](O1)[C@H]1OC[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]1O2 |
| InChI | InChI=1S/C24H30O5Si/c1-23(2,3)30(17-11-7-5-8-12-17,18-13-9-6-10-14-18)29-20-15-25-21-19-16-26-24(4,27-19)28-22(20)21/h5-14,19-22H,15-16H2,1-4H3/t19-,20+,21-,22-,24?/m1/s1 |
| InChIKey | ZNLKWCVZZZNTHF-POQMNXHYSA-N |
| XLogP | 2.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|