C26H40O3Si — CID 11396255
ethyl (2E,4E,6E,8E,10E,12E,14E,16S)-17-[tert-butyl(dimethyl)silyl]oxy-16-methylheptadeca-2,4,6,8,10,12,14-heptaenoate (PubChem CID 11396255) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E,12E,14E,16S)-17-[tert-butyl(dimethyl)silyl]oxy-16-methylheptadeca-2,4,6,8,10,12,14-heptaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E,12E,14E,16S)-17-[tert-butyl(dimethyl)silyl]oxy-16-methylheptadeca-2,4,6,8,10,12,14-heptaenoate |
|---|---|
| PubChem CID | 11396255 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E,12E,14E,16S)-17-[tert-butyl(dimethyl)silyl]oxy-16-methylheptadeca-2,4,6,8,10,12,14-heptaenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40O3Si/c1-8-28-25(27)22-20-18-16-14-12-10-9-11-13-15-17-19-21-24(2)23-29-30(6,7)26(3,4)5/h9-22,24H,8,23H2,1-7H3/b10-9+,13-11+,14-12+,17-15+,18-16+,21-19+,22-20+/t24-/m0/s1 |
| InChIKey | LALLLAIBGOQKMX-LWYAKRFESA-N |
| XLogP | 7.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|