C22H21ClF2N6 — CID 11396606
11-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 11396606) has the molecular formula C22H21ClF2N6 and a molecular weight of 442.90 g/mol. Its IUPAC name is 11-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 11-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 11396606 |
| Molecular Formula | C22H21ClF2N6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 11-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Cn1c2cc(Cl)ncc2c2ncnc(N3CCN(CCc4ccc(F)c(F)c4)CC3)c21 |
| InChI | InChI=1S/C22H21ClF2N6/c1-29-18-11-19(23)26-12-15(18)20-21(29)22(28-13-27-20)31-8-6-30(7-9-31)5-4-14-2-3-16(24)17(25)10-14/h2-3,10-13H,4-9H2,1H3 |
| InChIKey | XYFYDMWBHKXERO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|