C28H31FN2O3 — CID 11397079
N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide (PubChem CID 11397079) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide.
| Compound Name | N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
|---|---|
| PubChem CID | 11397079 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
| SMILES | CCOCCCNCc1ccc2c(c1)[C@@H](NC(=O)c1ccc(-c3ccccc3)cc1F)[C@H](O)C2 |
| InChI | InChI=1S/C28H31FN2O3/c1-2-34-14-6-13-30-18-19-9-10-22-17-26(32)27(24(22)15-19)31-28(33)23-12-11-21(16-25(23)29)20-7-4-3-5-8-20/h3-5,7-12,15-16,26-27,30,32H,2,6,13-14,17-18H2,1H3,(H,31,33)/t26-,27-/m1/s1 |
| InChIKey | MTPVUDNTLWISNB-KAYWLYCHSA-N |
| XLogP | 4.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|