C27H33N3O3S — CID 11397459
3-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 11397459) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 3-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 11397459 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 3-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | COc1ccccc1N1CCN(CCCCCCN2c3cccc4cccc(c34)S2(=O)=O)CC1 |
| InChI | InChI=1S/C27H33N3O3S/c1-33-25-14-5-4-12-23(25)29-20-18-28(19-21-29)16-6-2-3-7-17-30-24-13-8-10-22-11-9-15-26(27(22)24)34(30,31)32/h4-5,8-15H,2-3,6-7,16-21H2,1H3 |
| InChIKey | WTJYDHGHZDHLQW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|