C26H31FN4O4 — CID 11397519
methyl 2-[[(2S)-3-cyclohexyl-1-[2-(4-fluoroanilino)ethylamino]-1-oxopropan-2-yl]amino]-1,3-benzoxazole-6-carboxylate (PubChem CID 11397519) has the molecular formula C26H31FN4O4 and a molecular weight of 482.56 g/mol. Its IUPAC name is methyl 2-[[(2S)-3-cyclohexyl-1-[2-(4-fluoroanilino)ethylamino]-1-oxopropan-2-yl]amino]-1,3-benzoxazole-6-carboxylate.
| Compound Name | methyl 2-[[(2S)-3-cyclohexyl-1-[2-(4-fluoroanilino)ethylamino]-1-oxopropan-2-yl]amino]-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 11397519 |
| Molecular Formula | C26H31FN4O4 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | methyl 2-[[(2S)-3-cyclohexyl-1-[2-(4-fluoroanilino)ethylamino]-1-oxopropan-2-yl]amino]-1,3-benzoxazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N[C@@H](CC3CCCCC3)C(=O)NCCNc3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C26H31FN4O4/c1-34-25(33)18-7-12-21-23(16-18)35-26(30-21)31-22(15-17-5-3-2-4-6-17)24(32)29-14-13-28-20-10-8-19(27)9-11-20/h7-12,16-17,22,28H,2-6,13-15H2,1H3,(H,29,32)(H,30,31)/t22-/m0/s1 |
| InChIKey | IWUJMASENWQWSW-QFIPXVFZSA-N |
| XLogP | 4.73 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|