C27H27F3N2O3 — CID 11397561
(2R)-2-[(1S)-6,7-dimethoxy-1-[2-(2,3,6-trifluorophenyl)ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide (PubChem CID 11397561) has the molecular formula C27H27F3N2O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is (2R)-2-[(1S)-6,7-dimethoxy-1-[2-(2,3,6-trifluorophenyl)ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(1S)-6,7-dimethoxy-1-[2-(2,3,6-trifluorophenyl)ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 11397561 |
| Molecular Formula | C27H27F3N2O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | (2R)-2-[(1S)-6,7-dimethoxy-1-[2-(2,3,6-trifluorophenyl)ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide |
| SMILES | COc1cc2c(cc1OC)[C@H](CCc1c(F)ccc(F)c1F)N([C@@H](C(N)=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C27H27F3N2O3/c1-34-23-14-17-12-13-32(26(27(31)33)16-6-4-3-5-7-16)22(19(17)15-24(23)35-2)11-8-18-20(28)9-10-21(29)25(18)30/h3-7,9-10,14-15,22,26H,8,11-13H2,1-2H3,(H2,31,33)/t22-,26+/m0/s1 |
| InChIKey | ROGIGYXRGGHNRE-BKMJKUGQSA-N |
| XLogP | 4.88 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|