C23H26F3N5S2 — CID 11397777
2,4-dimethyl-5-[4-methyl-5-[3-[(1S,5R)-1-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-thiazole (PubChem CID 11397777) has the molecular formula C23H26F3N5S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is 2,4-dimethyl-5-[4-methyl-5-[3-[(1S,5R)-1-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-thiazole.
| Compound Name | 2,4-dimethyl-5-[4-methyl-5-[3-[(1S,5R)-1-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 11397777 |
| Molecular Formula | C23H26F3N5S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2,4-dimethyl-5-[4-methyl-5-[3-[(1S,5R)-1-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-thiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SCCCN3C[C@@H]4C[C@]4(c4ccc(C(F)(F)F)cc4)C3)n2C)s1 |
| InChI | InChI=1S/C23H26F3N5S2/c1-14-19(33-15(2)27-14)20-28-29-21(30(20)3)32-10-4-9-31-12-18-11-22(18,13-31)16-5-7-17(8-6-16)23(24,25)26/h5-8,18H,4,9-13H2,1-3H3/t18-,22+/m0/s1 |
| InChIKey | ODIJMXCJWMOZFJ-PGRDOPGGSA-N |
| XLogP | 5.33 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|