C30H33ClN4O — CID 11397926
(E)-N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 11397926) has the molecular formula C30H33ClN4O and a molecular weight of 501.07 g/mol. Its IUPAC name is (E)-N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 11397926 |
| Molecular Formula | C30H33ClN4O |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (E)-N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c[nH]c2ccccc12)NCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C30H33ClN4O/c31-22-14-15-25-28(19-22)35-27-12-6-4-10-24(27)30(25)33-18-8-2-1-7-17-32-29(36)16-13-21-20-34-26-11-5-3-9-23(21)26/h3,5,9,11,13-16,19-20,34H,1-2,4,6-8,10,12,17-18H2,(H,32,36)(H,33,35)/b16-13+ |
| InChIKey | GFHYZPMZHCOIER-DTQAZKPQSA-N |
| XLogP | 7.05 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|