C27H32N6O4 — CID 11397993
N-[3-(dimethylamino)propyl]-3-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzamide (PubChem CID 11397993) has the molecular formula C27H32N6O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 11397993 |
| Molecular Formula | C27H32N6O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[2-(3,4,5-trimethoxyanilino)pyrrolo[2,3-d]pyrimidin-7-yl]benzamide |
| SMILES | COc1cc(Nc2ncc3ccn(-c4cccc(C(=O)NCCCN(C)C)c4)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H32N6O4/c1-32(2)12-7-11-28-26(34)18-8-6-9-21(14-18)33-13-10-19-17-29-27(31-25(19)33)30-20-15-22(35-3)24(37-5)23(16-20)36-4/h6,8-10,13-17H,7,11-12H2,1-5H3,(H,28,34)(H,29,30,31) |
| InChIKey | JOERGFNRNZMWQP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|