C25H15ClF5NO3 — CID 11398071
3-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid (PubChem CID 11398071) has the molecular formula C25H15ClF5NO3 and a molecular weight of 507.84 g/mol. Its IUPAC name is 3-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 11398071 |
| Molecular Formula | C25H15ClF5NO3 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 3-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3cc(Cl)ccc3OCc3ccc(F)cc3F)ccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H15ClF5NO3/c26-16-5-8-22(35-13-15-4-6-17(27)12-20(15)28)19(11-16)21-7-9-23(25(29,30)31)32(21)18-3-1-2-14(10-18)24(33)34/h1-12H,13H2,(H,33,34) |
| InChIKey | KJNMYJDOGAOFGZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|