C31H28F3NOS — CID 11398267
(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine (PubChem CID 11398267) has the molecular formula C31H28F3NOS and a molecular weight of 519.63 g/mol. Its IUPAC name is (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine.
| Compound Name | (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine |
|---|---|
| PubChem CID | 11398267 |
| Molecular Formula | C31H28F3NOS |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine |
| SMILES | Fc1cc(F)c(COC[C@@H]2C[C@@H](SC(c3ccccc3)(c3ccccc3)c3ccccc3)CN2)cc1F |
| InChI | InChI=1S/C31H28F3NOS/c32-28-18-30(34)29(33)16-22(28)20-36-21-26-17-27(19-35-26)37-31(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,26-27,35H,17,19-21H2/t26-,27+/m0/s1 |
| InChIKey | SPXAMSSSXRLGIT-RRPNLBNLSA-N |
| XLogP | 7.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|