C29H58O4Si2 — CID 11398397
methyl 7-[(1R,2R)-2-but-3-enyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate (PubChem CID 11398397) has the molecular formula C29H58O4Si2 and a molecular weight of 526.95 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-but-3-enyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R)-2-but-3-enyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11398397 |
| Molecular Formula | C29H58O4Si2 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | methyl 7-[(1R,2R)-2-but-3-enyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopentyl]heptanoate |
| SMILES | C=CCC[C@H]1C(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C29H58O4Si2/c1-13-14-19-23-24(20-17-15-16-18-21-27(30)31-8)26(33-35(11,12)29(5,6)7)22-25(23)32-34(9,10)28(2,3)4/h13,23-26H,1,14-22H2,2-12H3/t23-,24-,25?,26?/m1/s1 |
| InChIKey | PWTBJXWGKRHHSX-TYPLQMOASA-N |
| XLogP | 8.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|