C30H56O5Si2 — CID 11398772
ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate (PubChem CID 11398772) has the molecular formula C30H56O5Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 11398772 |
| Molecular Formula | C30H56O5Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]oxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C30H56O5Si2/c1-16-18-24(34-36(12,13)29(6,7)8)26-27(33-26)25(35-37(14,15)30(9,10)11)22(4)19-21(3)20-23(5)28(31)32-17-2/h16,19-20,22,24-27H,1,17-18H2,2-15H3/b21-19+,23-20+/t22-,24-,25+,26+,27+/m1/s1 |
| InChIKey | OEGIDSPOEZHUIF-WLYZQDRYSA-N |
| XLogP | 8.20 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|