C18ClF15Si — CID 11398916
chloro-tris(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 11398916) has the molecular formula C18ClF15Si and a molecular weight of 564.71 g/mol. Its IUPAC name is chloro-tris(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | chloro-tris(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 11398916 |
| Molecular Formula | C18ClF15Si |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 563.92 |
| IUPAC Name | chloro-tris(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | Fc1c(F)c(F)c([Si](Cl)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18ClF15Si/c19-35(16-10(29)4(23)1(20)5(24)11(16)30,17-12(31)6(25)2(21)7(26)13(17)32)18-14(33)8(27)3(22)9(28)15(18)34 |
| InChIKey | MOJJQHJWGDJZBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|