C32H52O9 — CID 11399081
ditert-butyl (2R,3R,5R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate (PubChem CID 11399081) has the molecular formula C32H52O9 and a molecular weight of 580.76 g/mol. Its IUPAC name is ditert-butyl (2R,3R,5R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate.
| Compound Name | ditert-butyl (2R,3R,5R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11399081 |
| Molecular Formula | C32H52O9 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | ditert-butyl (2R,3R,5R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-8-nonyl-9-oxo-1,6-dioxaspiro[4.4]non-7-ene-2,3-dicarboxylate |
| SMILES | CCCCCCCCCC1=CO[C@@]2(C[C@@H](C(=O)OC(C)(C)C)[C@](CC(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)O2)C1=O |
| InChI | InChI=1S/C32H52O9/c1-11-12-13-14-15-16-17-18-22-21-37-32(25(22)34)19-23(26(35)39-29(5,6)7)31(41-32,27(36)40-30(8,9)10)20-24(33)38-28(2,3)4/h21,23H,11-20H2,1-10H3/t23-,31+,32+/m0/s1 |
| InChIKey | CMGWDTGXMKLUMS-RUAOOFDTSA-N |
| XLogP | 6.50 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|