C39H60O3Si2 — CID 11399456
(1R)-1-[(2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 11399456) has the molecular formula C39H60O3Si2 and a molecular weight of 633.08 g/mol. Its IUPAC name is (1R)-1-[(2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 11399456 |
| Molecular Formula | C39H60O3Si2 |
| Molecular Weight | 633.08 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | (1R)-1-[(2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CCCCCCCCC/C=C\C[C@H]1O[C@@H]([C@H](O)C#C[Si](C)(C)C)CC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H60O3Si2/c1-8-9-10-11-12-13-14-15-16-23-28-37-38(30-29-36(41-37)35(40)31-32-43(5,6)7)42-44(39(2,3)4,33-24-19-17-20-25-33)34-26-21-18-22-27-34/h16-27,35-38,40H,8-15,28-30H2,1-7H3/b23-16-/t35-,36-,37-,38-/m1/s1 |
| InChIKey | JQEHQDAGDXHCQW-OMNMRICNSA-N |
| XLogP | 8.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.08 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|