C26H33F3N4O7S2 — CID 11399466
(2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(3,4,5-trifluorophenyl)sulfonylamino]pentanoic acid (PubChem CID 11399466) has the molecular formula C26H33F3N4O7S2 and a molecular weight of 634.70 g/mol. Its IUPAC name is (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(3,4,5-trifluorophenyl)sulfonylamino]pentanoic acid.
| Compound Name | (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(3,4,5-trifluorophenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 11399466 |
| Molecular Formula | C26H33F3N4O7S2 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[(3,4,5-trifluorophenyl)sulfonylamino]pentanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@@H](NS(=O)(=O)c2cc(F)c(F)c(F)c2)C(=O)O)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C26H33F3N4O7S2/c1-13-14(2)23(15(3)17-8-9-26(4,5)40-22(13)17)42(38,39)33-25(30)31-10-6-7-20(24(34)35)32-41(36,37)16-11-18(27)21(29)19(28)12-16/h11-12,20,32H,6-10H2,1-5H3,(H,34,35)(H3,30,31,33)/t20-/m1/s1 |
| InChIKey | OMFFFWUDFSHCTE-HXUWFJFHSA-N |
| XLogP | 2.94 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|