C31H24F3N7O7 — CID 11399642
2-[[4-[6-(phenylcarbamoylamino)purin-9-yl]-2-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 11399642) has the molecular formula C31H24F3N7O7 and a molecular weight of 663.57 g/mol. Its IUPAC name is 2-[[4-[6-(phenylcarbamoylamino)purin-9-yl]-2-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[[4-[6-(phenylcarbamoylamino)purin-9-yl]-2-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11399642 |
| Molecular Formula | C31H24F3N7O7 |
| Molecular Weight | 663.57 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | 2-[[4-[6-(phenylcarbamoylamino)purin-9-yl]-2-[2-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ncnc2c1ncn2C1OC(COc2ncccc2C(=O)O)C2OC(c3ccccc3C(F)(F)F)OC21 |
| InChI | InChI=1S/C31H24F3N7O7/c32-31(33,34)19-11-5-4-9-17(19)29-47-22-20(13-45-26-18(28(42)43)10-6-12-35-26)46-27(23(22)48-29)41-15-38-21-24(36-14-37-25(21)41)40-30(44)39-16-7-2-1-3-8-16/h1-12,14-15,20,22-23,27,29H,13H2,(H,42,43)(H2,36,37,39,40,44) |
| InChIKey | NJPIRYDNDJIUNW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |