C39H47NO5SSi — CID 11399675
2-[(1R,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecan-3-yl]acetonitrile (PubChem CID 11399675) has the molecular formula C39H47NO5SSi and a molecular weight of 669.96 g/mol. Its IUPAC name is 2-[(1R,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecan-3-yl]acetonitrile.
| Compound Name | 2-[(1R,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 11399675 |
| Molecular Formula | C39H47NO5SSi |
| Molecular Weight | 669.96 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | 2-[(1R,3R,7S,8R,10R)-10-(benzenesulfonylmethyl)-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-6-oxo-9-oxatricyclo[5.3.1.03,8]undecan-3-yl]acetonitrile |
| SMILES | CC1(C)[C@H]2C[C@@]3(CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(=O)CC[C@]1(CC#N)[C@H]3O[C@H]2CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C39H47NO5SSi/c1-36(2,3)47(30-17-11-7-12-18-30,31-19-13-8-14-20-31)44-26-24-38-27-32-33(28-46(42,43)29-15-9-6-10-16-29)45-35(38)39(23-25-40,37(32,4)5)22-21-34(38)41/h6-20,32-33,35H,21-24,26-28H2,1-5H3/t32-,33-,35-,38-,39-/m0/s1 |
| InChIKey | IJZKRGJEVMZBEK-ZTXAFPGASA-N |
| XLogP | 6.49 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.96 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|