About CID 11399703
CID 11399703 (PubChem CID 11399703) has the molecular formula C25H34BiCl2N2O2
and a molecular weight of 674.45 g/mol.
Molecular Properties
| Compound Name | CID 11399703 |
| PubChem CID | 11399703 |
| Molecular Formula | C25H34BiCl2N2O2 |
| Molecular Weight | 674.45 g/mol |
| Exact Mass | 673.18 |
| IUPAC Name | — |
| SMILES | C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C9H16N2.2C8H9O.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;2*1-7-4-3-5-8(6-7)9-2;;;/h1-8H2;2*3,5-6H,1-2H3;;2*1H/q;;;+2;;/p-2 |
| InChIKey | KMRVGKIBQPXJPS-UHFFFAOYSA-L |
| XLogP | 5.02 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 674.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11399703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11399703?
The IUPAC name of CID 11399703 (CID 11399703) is not available.
What is the SMILES notation for CID 11399703?
The canonical SMILES for CID 11399703 is C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccc(OC)cc2C)c(C)c1.
What is the InChIKey of CID 11399703?
The InChIKey is KMRVGKIBQPXJPS-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16N2.2C8H9O.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;2*1-7-4-3-5-8(6-7)9-2;;;/h1-8H2;2*3,5-6H,1-2H3;;2*1H/q;;;+2;;/p-2.
What are the key properties of CID 11399703?
CID 11399703 has a molecular weight of 674.45 g/mol, XLogP of 5.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11399703 is sourced from PubChem (CID 11399703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).