C36H37N7O7 — CID 11399725
2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-(4-phenylphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 11399725) has the molecular formula C36H37N7O7 and a molecular weight of 679.73 g/mol. Its IUPAC name is 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-(4-phenylphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-(4-phenylphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11399725 |
| Molecular Formula | C36H37N7O7 |
| Molecular Weight | 679.73 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-(4-phenylphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | CCCCCCNC(=O)Nc1ncnc2c1ncn2C1OC(COc2ncccc2C(=O)O)C2OC(c3ccc(-c4ccccc4)cc3)OC21 |
| InChI | InChI=1S/C36H37N7O7/c1-2-3-4-8-17-38-36(46)42-30-27-31(40-20-39-30)43(21-41-27)33-29-28(26(48-33)19-47-32-25(34(44)45)12-9-18-37-32)49-35(50-29)24-15-13-23(14-16-24)22-10-6-5-7-11-22/h5-7,9-16,18,20-21,26,28-29,33,35H,2-4,8,17,19H2,1H3,(H,44,45)(H2,38,39,40,42,46) |
| InChIKey | SZHOYACYKIGNHL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.73 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|