About (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol
(1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol (PubChem CID 11399771) has the molecular formula C29H26O2P2
and a molecular weight of 468.47 g/mol. Its IUPAC name is (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol |
| PubChem CID | 11399771 |
| Molecular Formula | C29H26O2P2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol |
| SMILES | CO/C(O)=C\C=C(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26O2P2/c1-31-28(30)22-23-29(32(24-14-6-2-7-15-24)25-16-8-3-9-17-25)33(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-23,30H,1H3/b28-22- |
| InChIKey | BIHDIDPLCHKMTB-SLMZUGIISA-N |
| XLogP | 6.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol?
The IUPAC name of (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol (CID 11399771) is (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol.
What is the SMILES notation for (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol?
The canonical SMILES for (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol is CO/C(O)=C\C=C(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.
What is the InChIKey of (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol?
The InChIKey is BIHDIDPLCHKMTB-SLMZUGIISA-N. The full InChI is InChI=1S/C29H26O2P2/c1-31-28(30)22-23-29(32(24-14-6-2-7-15-24)25-16-8-3-9-17-25)33(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-23,30H,1H3/b28-22-.
What are the key properties of (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol?
(1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol has a molecular weight of 468.47 g/mol, XLogP of 6.14, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-4,4-bis(diphenylphosphanyl)-1-methoxybuta-1,3-dien-1-ol is sourced from PubChem (CID 11399771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).