C31H28Cl2O10S2 — CID 11399793
10-[(1R,2R)-2-phenoxathiin-10-ium-10-ylcycloheptyl]phenoxathiin-10-ium diperchlorate (PubChem CID 11399793) has the molecular formula C31H28Cl2O10S2 and a molecular weight of 695.60 g/mol. Its IUPAC name is 10-[(1R,2R)-2-phenoxathiin-10-ium-10-ylcycloheptyl]phenoxathiin-10-ium diperchlorate.
| Compound Name | 10-[(1R,2R)-2-phenoxathiin-10-ium-10-ylcycloheptyl]phenoxathiin-10-ium diperchlorate |
|---|---|
| PubChem CID | 11399793 |
| Molecular Formula | C31H28Cl2O10S2 |
| Molecular Weight | 695.60 g/mol |
| Exact Mass | 694.05 |
| IUPAC Name | 10-[(1R,2R)-2-phenoxathiin-10-ium-10-ylcycloheptyl]phenoxathiin-10-ium diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1ccc2c(c1)Oc1ccccc1[S+]2[C@@H]1CCCCC[C@H]1[S+]1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C31H28O2S2.2ClHO4/c1-2-20-30(34-26-16-8-4-12-22(26)32-23-13-5-9-17-27(23)34)31(21-3-1)35-28-18-10-6-14-24(28)33-25-15-7-11-19-29(25)35;2*2-1(3,4)5/h4-19,30-31H,1-3,20-21H2;2*(H,2,3,4,5)/q+2;;/p-2/t30-,31-;;/m1../s1 |
| InChIKey | LGFXTVARTWBZPX-ZAMYOOMVSA-L |
| XLogP | -1.14 |
| TPSA | 202.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.60 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|