C10H9N3O4S2 — CID 114001401
3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid (PubChem CID 114001401) has the molecular formula C10H9N3O4S2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114001401 |
| Molecular Formula | C10H9N3O4S2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1ccsc1C(=O)O |
| InChI | InChI=1S/C10H9N3O4S2/c1-13-10(11-7(14)8(15)12-13)19-4-5-2-3-18-6(5)9(16)17/h2-3H,4H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | GHQXKJMLBLZLQE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|