C9H8BrN5O2S — CID 114001460
3-(6-bromo-2-methylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 114001460) has the molecular formula C9H8BrN5O2S and a molecular weight of 330.17 g/mol. Its IUPAC name is 3-(6-bromo-2-methylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(6-bromo-2-methylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 114001460 |
| Molecular Formula | C9H8BrN5O2S |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 3-(6-bromo-2-methylpyrimidin-4-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cc1nc(Br)cc(Sc2nc(=O)c(=O)[nH]n2C)n1 |
| InChI | InChI=1S/C9H8BrN5O2S/c1-4-11-5(10)3-6(12-4)18-9-13-7(16)8(17)14-15(9)2/h3H,1-2H3,(H,14,17) |
| InChIKey | UXPNBPBQJDTAET-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|