C7H8F3N3O3S — CID 114001469
2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)sulfanyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 114001469) has the molecular formula C7H8F3N3O3S and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)sulfanyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)sulfanyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 114001469 |
| Molecular Formula | C7H8F3N3O3S |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)sulfanyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCC(O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O3S/c1-13-6(11-4(15)5(16)12-13)17-2-3(14)7(8,9)10/h3,14H,2H2,1H3,(H,12,16) |
| InChIKey | DOXWDSJFAQRLEG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|