C10H17N5O3S — CID 114001510
2-amino-2-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanamide (PubChem CID 114001510) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanamide.
| Compound Name | 2-amino-2-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanamide |
|---|---|
| PubChem CID | 114001510 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-amino-2-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanamide |
| SMILES | CC(CC(C)(N)C(N)=O)Sc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C10H17N5O3S/c1-5(4-10(2,12)8(11)18)19-9-13-6(16)7(17)14-15(9)3/h5H,4,12H2,1-3H3,(H2,11,18)(H,14,17) |
| InChIKey | GAJSVNKBKZYTNX-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|