C12H9Br2Cl2NO — CID 114001608
4-bromo-N-[1-(5-bromofuran-2-yl)ethyl]-2,3-dichloroaniline (PubChem CID 114001608) has the molecular formula C12H9Br2Cl2NO and a molecular weight of 413.92 g/mol. Its IUPAC name is 4-bromo-N-[1-(5-bromofuran-2-yl)ethyl]-2,3-dichloroaniline.
| Compound Name | 4-bromo-N-[1-(5-bromofuran-2-yl)ethyl]-2,3-dichloroaniline |
|---|---|
| PubChem CID | 114001608 |
| Molecular Formula | C12H9Br2Cl2NO |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 410.84 |
| IUPAC Name | 4-bromo-N-[1-(5-bromofuran-2-yl)ethyl]-2,3-dichloroaniline |
| SMILES | CC(Nc1ccc(Br)c(Cl)c1Cl)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H9Br2Cl2NO/c1-6(9-4-5-10(14)18-9)17-8-3-2-7(13)11(15)12(8)16/h2-6,17H,1H3 |
| InChIKey | AORHYMKIKPIQSO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|