About 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile
4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile (PubChem CID 114001948) has the molecular formula C13H7N3O2
and a molecular weight of 237.22 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile |
| PubChem CID | 114001948 |
| Molecular Formula | C13H7N3O2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile |
| SMILES | CC1=CC(=O)N(c2ccc(C#N)c(C#N)c2)C1=O |
| InChI | InChI=1S/C13H7N3O2/c1-8-4-12(17)16(13(8)18)11-3-2-9(6-14)10(5-11)7-15/h2-5H,1H3 |
| InChIKey | HQPCWCSEHIERCX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile (CID 114001948) is 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile is CC1=CC(=O)N(c2ccc(C#N)c(C#N)c2)C1=O.
What is the InChIKey of 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile?
The InChIKey is HQPCWCSEHIERCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3O2/c1-8-4-12(17)16(13(8)18)11-3-2-9(6-14)10(5-11)7-15/h2-5H,1H3.
What are the key properties of 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile?
4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile has a molecular weight of 237.22 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 114001948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).