About N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine
N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine (PubChem CID 114002343) has the molecular formula C12H10BrCl2N3
and a molecular weight of 347.04 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine.
Molecular Properties
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine |
| PubChem CID | 114002343 |
| Molecular Formula | C12H10BrCl2N3 |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1ccnc1Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H10BrCl2N3/c1-2-6-18-7-5-16-12(18)17-9-4-3-8(13)10(14)11(9)15/h2-5,7H,1,6H2,(H,16,17) |
| InChIKey | URIHWEVQBIONRJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine?
The IUPAC name of N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine (CID 114002343) is N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine.
What is the SMILES notation for N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine?
The canonical SMILES for N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine is C=CCn1ccnc1Nc1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine?
The InChIKey is URIHWEVQBIONRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrCl2N3/c1-2-6-18-7-5-16-12(18)17-9-4-3-8(13)10(14)11(9)15/h2-5,7H,1,6H2,(H,16,17).
What are the key properties of N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine?
N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine has a molecular weight of 347.04 g/mol, XLogP of 4.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,3-dichlorophenyl)-1-prop-2-enylimidazol-2-amine is sourced from PubChem (CID 114002343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).