About N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine
N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine (PubChem CID 114003022) has the molecular formula C14H18N2S2
and a molecular weight of 278.45 g/mol. Its IUPAC name is N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine |
| PubChem CID | 114003022 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine |
| SMILES | CC1(C)CSCC(Nc2ccc3ncsc3c2)C1 |
| InChI | InChI=1S/C14H18N2S2/c1-14(2)6-11(7-17-8-14)16-10-3-4-12-13(5-10)18-9-15-12/h3-5,9,11,16H,6-8H2,1-2H3 |
| InChIKey | JWRXWFXHWFRVPE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine?
The IUPAC name of N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine (CID 114003022) is N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine?
The canonical SMILES for N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine is CC1(C)CSCC(Nc2ccc3ncsc3c2)C1.
What is the InChIKey of N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine?
The InChIKey is JWRXWFXHWFRVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S2/c1-14(2)6-11(7-17-8-14)16-10-3-4-12-13(5-10)18-9-15-12/h3-5,9,11,16H,6-8H2,1-2H3.
What are the key properties of N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine?
N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine has a molecular weight of 278.45 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dimethylthian-3-yl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 114003022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).