C14H10ClN3O — CID 114003049
4-chloro-N-(2-cyano-3-methylphenyl)pyridine-3-carboxamide (PubChem CID 114003049) has the molecular formula C14H10ClN3O and a molecular weight of 271.71 g/mol. Its IUPAC name is 4-chloro-N-(2-cyano-3-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(2-cyano-3-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114003049 |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-chloro-N-(2-cyano-3-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cnccc2Cl)c1C#N |
| InChI | InChI=1S/C14H10ClN3O/c1-9-3-2-4-13(10(9)7-16)18-14(19)11-8-17-6-5-12(11)15/h2-6,8H,1H3,(H,18,19) |
| InChIKey | SBNVOTUZFYGBKV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |