C13H23NO4 — CID 114006236
4-(3-cyclohexylpropanoylamino)-2-hydroxybutanoic acid (PubChem CID 114006236) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(3-cyclohexylpropanoylamino)-2-hydroxybutanoic acid.
| Compound Name | 4-(3-cyclohexylpropanoylamino)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114006236 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-(3-cyclohexylpropanoylamino)-2-hydroxybutanoic acid |
| SMILES | O=C(CCC1CCCCC1)NCCC(O)C(=O)O |
| InChI | InChI=1S/C13H23NO4/c15-11(13(17)18)8-9-14-12(16)7-6-10-4-2-1-3-5-10/h10-11,15H,1-9H2,(H,14,16)(H,17,18) |
| InChIKey | OSVMZYWBOHXIQF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |