C11H11BrClNO4 — CID 114006650
(2S)-4-[(4-bromo-2-chlorobenzoyl)amino]-2-hydroxybutanoic acid (PubChem CID 114006650) has the molecular formula C11H11BrClNO4 and a molecular weight of 336.57 g/mol. Its IUPAC name is (2S)-4-[(4-bromo-2-chlorobenzoyl)amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(4-bromo-2-chlorobenzoyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114006650 |
| Molecular Formula | C11H11BrClNO4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | (2S)-4-[(4-bromo-2-chlorobenzoyl)amino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCC[C@H](O)C(=O)O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H11BrClNO4/c12-6-1-2-7(8(13)5-6)10(16)14-4-3-9(15)11(17)18/h1-2,5,9,15H,3-4H2,(H,14,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | XSRKRZBUYMKFHG-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |